C38H58O9P2 — CID 158251127
dihydroxyphosphanyl dihydrogen phosphite;1,1,3-tris(2-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol (PubChem CID 158251127) has the molecular formula C38H58O9P2 and a molecular weight of 720.82 g/mol. Its IUPAC name is dihydroxyphosphanyl dihydrogen phosphite;1,1,3-tris(2-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol.
| Compound Name | dihydroxyphosphanyl dihydrogen phosphite;1,1,3-tris(2-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 158251127 |
| Molecular Formula | C38H58O9P2 |
| Molecular Weight | 720.82 g/mol |
| Exact Mass | 720.36 |
| IUPAC Name | dihydroxyphosphanyl dihydrogen phosphite;1,1,3-tris(2-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol |
| SMILES | CCCCc1cc(C)ccc1C(O)C(CO)(CO)C(O)(c1ccc(C)cc1CCCC)c1ccc(C)cc1CCCC.OP(O)OP(O)O |
| InChI | InChI=1S/C38H54O4.H4O5P2/c1-7-10-13-30-22-27(4)16-19-33(30)36(41)37(25-39,26-40)38(42,34-20-17-28(5)23-31(34)14-11-8-2)35-21-18-29(6)24-32(35)15-12-9-3;1-6(2)5-7(3)4/h16-24,36,39-42H,7-15,25-26H2,1-6H3;1-4H |
| InChIKey | GGSMMERVEKVTDA-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.82 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|