C19H29FN4O2 — CID 158251311
(3aS,6aR)-5-[3-[(2R,4S)-4-fluoro-2-isocyanopyrrolidin-1-yl]-3-oxopropyl]-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 158251311) has the molecular formula C19H29FN4O2 and a molecular weight of 364.47 g/mol. Its IUPAC name is (3aS,6aR)-5-[3-[(2R,4S)-4-fluoro-2-isocyanopyrrolidin-1-yl]-3-oxopropyl]-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-5-[3-[(2R,4S)-4-fluoro-2-isocyanopyrrolidin-1-yl]-3-oxopropyl]-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 158251311 |
| Molecular Formula | C19H29FN4O2 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (3aS,6aR)-5-[3-[(2R,4S)-4-fluoro-2-isocyanopyrrolidin-1-yl]-3-oxopropyl]-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | [C-]#[N+][C@@H]1C[C@H](F)CN1C(=O)CCC1(C)C[C@H]2CN(C(=O)N(C)C)C[C@H]2C1 |
| InChI | InChI=1S/C19H29FN4O2/c1-19(6-5-17(25)24-12-15(20)7-16(24)21-2)8-13-10-23(11-14(13)9-19)18(26)22(3)4/h13-16H,5-12H2,1,3-4H3/t13-,14+,15-,16-,19?/m0/s1 |
| InChIKey | SGIPLPUTAWMSQH-ZSCFFZQTSA-N |
| XLogP | 2.61 |
| TPSA | 48.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|