C45H58N2O4S — CID 158251484
(5S)-2-benzyl-7-methyl-N-[4-methyl-1-(1-methylcyclopropyl)-1-oxopentan-2-yl]-4-oxo-5-[[(2R)-5-phenyl-2-(2-phenylethyl)-4-sulfanylidenepentanoyl]amino]octanamide (PubChem CID 158251484) has the molecular formula C45H58N2O4S and a molecular weight of 723.04 g/mol. Its IUPAC name is (5S)-2-benzyl-7-methyl-N-[4-methyl-1-(1-methylcyclopropyl)-1-oxopentan-2-yl]-4-oxo-5-[[(2R)-5-phenyl-2-(2-phenylethyl)-4-sulfanylidenepentanoyl]amino]octanamide.
| Compound Name | (5S)-2-benzyl-7-methyl-N-[4-methyl-1-(1-methylcyclopropyl)-1-oxopentan-2-yl]-4-oxo-5-[[(2R)-5-phenyl-2-(2-phenylethyl)-4-sulfanylidenepentanoyl]amino]octanamide |
|---|---|
| PubChem CID | 158251484 |
| Molecular Formula | C45H58N2O4S |
| Molecular Weight | 723.04 g/mol |
| Exact Mass | 722.41 |
| IUPAC Name | (5S)-2-benzyl-7-methyl-N-[4-methyl-1-(1-methylcyclopropyl)-1-oxopentan-2-yl]-4-oxo-5-[[(2R)-5-phenyl-2-(2-phenylethyl)-4-sulfanylidenepentanoyl]amino]octanamide |
| SMILES | CC(C)CC(NC(=O)C(CC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCc1ccccc1)CC(=S)Cc1ccccc1)Cc1ccccc1)C(=O)C1(C)CC1 |
| InChI | InChI=1S/C45H58N2O4S/c1-31(2)25-39(46-43(50)36(22-21-33-15-9-6-10-16-33)29-38(52)28-35-19-13-8-14-20-35)41(48)30-37(27-34-17-11-7-12-18-34)44(51)47-40(26-32(3)4)42(49)45(5)23-24-45/h6-20,31-32,36-37,39-40H,21-30H2,1-5H3,(H,46,50)(H,47,51)/t36-,37?,39+,40?/m1/s1 |
| InChIKey | GWIJLKMYOMIERG-WPPWZYQWSA-N |
| XLogP | 8.49 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.04 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|