About [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid
[1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid (PubChem CID 158252236) has the molecular formula C15H25N3O8
and a molecular weight of 375.38 g/mol. Its IUPAC name is [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid.
Molecular Properties
| Compound Name | [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid |
| PubChem CID | 158252236 |
| Molecular Formula | C15H25N3O8 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid |
| SMILES | CC(C)(N)CCC(=O)N1CCC(O[N+](=O)[O-])CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H21N3O4.C4H4O4/c1-11(2,12)6-3-10(15)13-7-4-9(5-8-13)18-14(16)17;5-3(6)1-2-4(7)8/h9H,3-8,12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | GGVXOAHOOJAFCD-WLHGVMLRSA-N |
| XLogP | 0.41 |
| TPSA | 173.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid?
The IUPAC name of [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid (CID 158252236) is [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid.
What is the SMILES notation for [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid?
The canonical SMILES for [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid is CC(C)(N)CCC(=O)N1CCC(O[N+](=O)[O-])CC1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid?
The InChIKey is GGVXOAHOOJAFCD-WLHGVMLRSA-N. The full InChI is InChI=1S/C11H21N3O4.C4H4O4/c1-11(2,12)6-3-10(15)13-7-4-9(5-8-13)18-14(16)17;5-3(6)1-2-4(7)8/h9H,3-8,12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid?
[1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid has a molecular weight of 375.38 g/mol, XLogP of 0.41, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-amino-4-methylpentanoyl)piperidin-4-yl] nitrate;(E)-but-2-enedioic acid is sourced from PubChem (CID 158252236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).