C38H48Br2N8O6 — CID 158253099
tert-butyl (3R)-3-[(3-amino-6-bromoquinolin-4-yl)amino]piperidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 158253099) has the molecular formula C38H48Br2N8O6 and a molecular weight of 872.66 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(3-amino-6-bromoquinolin-4-yl)amino]piperidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(3-amino-6-bromoquinolin-4-yl)amino]piperidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 158253099 |
| Molecular Formula | C38H48Br2N8O6 |
| Molecular Weight | 872.66 g/mol |
| Exact Mass | 870.21 |
| IUPAC Name | tert-butyl (3R)-3-[(3-amino-6-bromoquinolin-4-yl)amino]piperidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Nc2c(N)cnc3ccc(Br)cc23)C1.CC(C)(C)OC(=O)N1CCC[C@@H](Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)C1 |
| InChI | InChI=1S/C19H23BrN4O4.C19H25BrN4O2/c1-19(2,3)28-18(25)23-8-4-5-13(11-23)22-17-14-9-12(20)6-7-15(14)21-10-16(17)24(26)27;1-19(2,3)26-18(25)24-8-4-5-13(11-24)23-17-14-9-12(20)6-7-16(14)22-10-15(17)21/h6-7,9-10,13H,4-5,8,11H2,1-3H3,(H,21,22);6-7,9-10,13H,4-5,8,11,21H2,1-3H3,(H,22,23)/t2*13-/m11/s1 |
| InChIKey | GGYLMYNMNMKTMQ-DKAPBGRZSA-N |
| XLogP | 9.11 |
| TPSA | 178.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.66 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|