About thiophen-3-amine;N-thiophen-3-ylpentanamide
thiophen-3-amine;N-thiophen-3-ylpentanamide (PubChem CID 158253806) has the molecular formula C13H18N2OS2
and a molecular weight of 282.43 g/mol. Its IUPAC name is thiophen-3-amine;N-thiophen-3-ylpentanamide.
Molecular Properties
| Compound Name | thiophen-3-amine;N-thiophen-3-ylpentanamide |
| PubChem CID | 158253806 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | thiophen-3-amine;N-thiophen-3-ylpentanamide |
| SMILES | CCCCC(=O)Nc1ccsc1.Nc1ccsc1 |
| InChI | InChI=1S/C9H13NOS.C4H5NS/c1-2-3-4-9(11)10-8-5-6-12-7-8;5-4-1-2-6-3-4/h5-7H,2-4H2,1H3,(H,10,11);1-3H,5H2 |
| InChIKey | GHAMCZNHPSHBNN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thiophen-3-amine;N-thiophen-3-ylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-3-amine;N-thiophen-3-ylpentanamide?
The IUPAC name of thiophen-3-amine;N-thiophen-3-ylpentanamide (CID 158253806) is thiophen-3-amine;N-thiophen-3-ylpentanamide.
What is the SMILES notation for thiophen-3-amine;N-thiophen-3-ylpentanamide?
The canonical SMILES for thiophen-3-amine;N-thiophen-3-ylpentanamide is CCCCC(=O)Nc1ccsc1.Nc1ccsc1.
What is the InChIKey of thiophen-3-amine;N-thiophen-3-ylpentanamide?
The InChIKey is GHAMCZNHPSHBNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NOS.C4H5NS/c1-2-3-4-9(11)10-8-5-6-12-7-8;5-4-1-2-6-3-4/h5-7H,2-4H2,1H3,(H,10,11);1-3H,5H2.
What are the key properties of thiophen-3-amine;N-thiophen-3-ylpentanamide?
thiophen-3-amine;N-thiophen-3-ylpentanamide has a molecular weight of 282.43 g/mol, XLogP of 4.21, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-3-amine;N-thiophen-3-ylpentanamide is sourced from PubChem (CID 158253806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).