About CID 158253944
CID 158253944 (PubChem CID 158253944) has the molecular formula C24H22B44ClF2NO2S
and a molecular weight of 937.69 g/mol.
Molecular Properties
| Compound Name | CID 158253944 |
| PubChem CID | 158253944 |
| Molecular Formula | C24H22B44ClF2NO2S |
| Molecular Weight | 937.69 g/mol |
| Exact Mass | 945.51 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)N2c3cc(F)ccc3CCC2CCc2ccc(F)c(Cl)c2)cc1.[B]B([B])B([B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C24H22ClF2NO2S.B44/c1-16-2-11-21(12-3-16)31(29,30)28-20(9-4-17-5-13-23(27)22(25)14-17)10-7-18-6-8-19(26)15-24(18)28;1-24(2)35(23)41(36(25(3)4)26(5)6)44(42(37(27(7)8)28(9)10)38(29(11)12)30(13)14)43(39(31(15)16)32(17)18)40(33(19)20)34(21)22/h2-3,5-6,8,11-15,20H,4,7,9-10H2,1H3; |
| InChIKey | VITMMGODLCINHS-UHFFFAOYSA-N |
| XLogP | -10.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 75 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 937.69 |
| LogP ≤ 5 | -10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158253944 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158253944?
The IUPAC name of CID 158253944 (CID 158253944) is not available.
What is the SMILES notation for CID 158253944?
The canonical SMILES for CID 158253944 is Cc1ccc(S(=O)(=O)N2c3cc(F)ccc3CCC2CCc2ccc(F)c(Cl)c2)cc1.[B]B([B])B([B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B].
What is the InChIKey of CID 158253944?
The InChIKey is VITMMGODLCINHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22ClF2NO2S.B44/c1-16-2-11-21(12-3-16)31(29,30)28-20(9-4-17-5-13-23(27)22(25)14-17)10-7-18-6-8-19(26)15-24(18)28;1-24(2)35(23)41(36(25(3)4)26(5)6)44(42(37(27(7)8)28(9)10)38(29(11)12)30(13)14)43(39(31(15)16)32(17)18)40(33(19)20)34(21)22/h2-3,5-6,8,11-15,20H,4,7,9-10H2,1H3;.
What are the key properties of CID 158253944?
CID 158253944 has a molecular weight of 937.69 g/mol, XLogP of -10.69, 25 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158253944 is sourced from PubChem (CID 158253944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).