C50H48F6N2O7 — CID 158254003
2-[2-methyl-4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]butoxy]phenoxy]acetic acid;2-[4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]acetic acid (PubChem CID 158254003) has the molecular formula C50H48F6N2O7 and a molecular weight of 902.93 g/mol. Its IUPAC name is 2-[2-methyl-4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]butoxy]phenoxy]acetic acid;2-[4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]acetic acid.
| Compound Name | 2-[2-methyl-4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]butoxy]phenoxy]acetic acid;2-[4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 158254003 |
| Molecular Formula | C50H48F6N2O7 |
| Molecular Weight | 902.93 g/mol |
| Exact Mass | 902.34 |
| IUPAC Name | 2-[2-methyl-4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]butoxy]phenoxy]acetic acid;2-[4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]acetic acid |
| SMILES | CCCC(Oc1ccc(OCC(=O)O)c(C)c1)c1cccc(-c2ccc(C(F)(F)F)cc2)n1.CCCCC(Oc1ccc(CC(=O)O)cc1)c1cccc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C25H24F3NO4.C25H24F3NO3/c1-3-5-23(33-19-12-13-22(16(2)14-19)32-15-24(30)31)21-7-4-6-20(29-21)17-8-10-18(11-9-17)25(26,27)28;1-2-3-7-23(32-20-14-8-17(9-15-20)16-24(30)31)22-6-4-5-21(29-22)18-10-12-19(13-11-18)25(26,27)28/h4,6-14,23H,3,5,15H2,1-2H3,(H,30,31);4-6,8-15,23H,2-3,7,16H2,1H3,(H,30,31) |
| InChIKey | GHBBJRSAUCIFON-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.93 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |