C26H33F6N3O3 — CID 158254380
2-[[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-6-hydroxy-2-phenylhexan-2-yl]-methylamino]ethylurea (PubChem CID 158254380) has the molecular formula C26H33F6N3O3 and a molecular weight of 549.56 g/mol. Its IUPAC name is 2-[[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-6-hydroxy-2-phenylhexan-2-yl]-methylamino]ethylurea.
| Compound Name | 2-[[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-6-hydroxy-2-phenylhexan-2-yl]-methylamino]ethylurea |
|---|---|
| PubChem CID | 158254380 |
| Molecular Formula | C26H33F6N3O3 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 2-[[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-6-hydroxy-2-phenylhexan-2-yl]-methylamino]ethylurea |
| SMILES | C[C@@H](OC[C@](CCCCO)(c1ccccc1)N(C)CCNC(N)=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H33F6N3O3/c1-18(19-14-21(25(27,28)29)16-22(15-19)26(30,31)32)38-17-24(10-6-7-13-36,20-8-4-3-5-9-20)35(2)12-11-34-23(33)37/h3-5,8-9,14-16,18,36H,6-7,10-13,17H2,1-2H3,(H3,33,34,37)/t18-,24-/m1/s1 |
| InChIKey | GHCFGFGHTWNGEC-HOYKHHGWSA-N |
| XLogP | 5.46 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|