C14H15F2NO — CID 158254960
carbanide;[2,6-difluoro-4-(3-methoxyphenyl)phenyl]azanium (PubChem CID 158254960) has the molecular formula C14H15F2NO and a molecular weight of 251.28 g/mol. Its IUPAC name is carbanide;[2,6-difluoro-4-(3-methoxyphenyl)phenyl]azanium.
| Compound Name | carbanide;[2,6-difluoro-4-(3-methoxyphenyl)phenyl]azanium |
|---|---|
| PubChem CID | 158254960 |
| Molecular Formula | C14H15F2NO |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | carbanide;[2,6-difluoro-4-(3-methoxyphenyl)phenyl]azanium |
| SMILES | COc1cccc(-c2cc(F)c([NH3+])c(F)c2)c1.[CH3-] |
| InChI | InChI=1S/C13H11F2NO.CH3/c1-17-10-4-2-3-8(5-10)9-6-11(14)13(16)12(15)7-9;/h2-7H,16H2,1H3;1H3/q;-1/p+1 |
| InChIKey | GHEBESSQVRWVMJ-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|