C40H52N4O4 — CID 15825509
ethyl 4-[[4,6-bis(4-octoxyphenyl)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 15825509) has the molecular formula C40H52N4O4 and a molecular weight of 652.88 g/mol. Its IUPAC name is ethyl 4-[[4,6-bis(4-octoxyphenyl)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4,6-bis(4-octoxyphenyl)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 15825509 |
| Molecular Formula | C40H52N4O4 |
| Molecular Weight | 652.88 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | ethyl 4-[[4,6-bis(4-octoxyphenyl)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2nc(Nc3ccc(C(=O)OCC)cc3)nc(-c3ccc(OCCCCCCCC)cc3)n2)cc1 |
| InChI | InChI=1S/C40H52N4O4/c1-4-7-9-11-13-15-29-47-35-25-19-31(20-26-35)37-42-38(32-21-27-36(28-22-32)48-30-16-14-12-10-8-5-2)44-40(43-37)41-34-23-17-33(18-24-34)39(45)46-6-3/h17-28H,4-16,29-30H2,1-3H3,(H,41,42,43,44) |
| InChIKey | QLCRHKCIVUVWFF-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.88 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|