C39H45F2N3O3S2 — CID 158256045
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(6-fluoro-3-pyridinyl)thiophen-3-yl]methanone;5-(6-fluoro-3-pyridinyl)thiophene-3-carboxylic acid (PubChem CID 158256045) has the molecular formula C39H45F2N3O3S2 and a molecular weight of 705.94 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(6-fluoro-3-pyridinyl)thiophen-3-yl]methanone;5-(6-fluoro-3-pyridinyl)thiophene-3-carboxylic acid.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(6-fluoro-3-pyridinyl)thiophen-3-yl]methanone;5-(6-fluoro-3-pyridinyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 158256045 |
| Molecular Formula | C39H45F2N3O3S2 |
| Molecular Weight | 705.94 g/mol |
| Exact Mass | 705.29 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(6-fluoro-3-pyridinyl)thiophen-3-yl]methanone;5-(6-fluoro-3-pyridinyl)thiophene-3-carboxylic acid |
| SMILES | C1CCC2CCCCC2C1.O=C(O)c1csc(-c2ccc(F)nc2)c1.O=C(c1csc(-c2ccc(F)nc2)c1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C19H21FN2OS.C10H6FNO2S.C10H18/c20-18-8-7-14(11-21-18)17-10-15(12-24-17)19(23)22-9-3-5-13-4-1-2-6-16(13)22;11-9-2-1-6(4-12-9)8-3-7(5-15-8)10(13)14;1-2-6-10-8-4-3-7-9(10)5-1/h7-8,10-13,16H,1-6,9H2;1-5H,(H,13,14);9-10H,1-8H2 |
| InChIKey | GHHJRIOXYTZVNM-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.94 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|