C6H3F11 — CID 15825708
1,1,1,2,2,5,5,5-octafluoro-4-(trifluoromethyl)pentane (PubChem CID 15825708) has the molecular formula C6H3F11 and a molecular weight of 284.07 g/mol. Its IUPAC name is 1,1,1,2,2,5,5,5-octafluoro-4-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,2,5,5,5-octafluoro-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 15825708 |
| Molecular Formula | C6H3F11 |
| Molecular Weight | 284.07 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 1,1,1,2,2,5,5,5-octafluoro-4-(trifluoromethyl)pentane |
| SMILES | FC(F)(F)C(CC(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H3F11/c7-3(8,6(15,16)17)1-2(4(9,10)11)5(12,13)14/h2H,1H2 |
| InChIKey | HOPIMNPCVOTFDN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.07 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|