C58H58F4N10O4S2 — CID 158257238
8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethylimidazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 158257238) has the molecular formula C58H58F4N10O4S2 and a molecular weight of 1099.29 g/mol. Its IUPAC name is 8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethylimidazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethylimidazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 158257238 |
| Molecular Formula | C58H58F4N10O4S2 |
| Molecular Weight | 1099.29 g/mol |
| Exact Mass | 1098.40 |
| IUPAC Name | 8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethylimidazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | Cc1ncn(C)c1-c1cnc2c3cncc(S(C)(=O)=O)c3n(C(c3ccccc3)C3CCC(F)(F)CC3)c2c1.Cc1ncn(C)c1-c1cnc2c3cncc(S(C)(=O)=O)c3n(C(c3ccccc3)C3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/2C29H29F2N5O2S/c2*1-18-26(35(2)17-34-18)21-13-23-25(33-14-21)22-15-32-16-24(39(3,37)38)28(22)36(23)27(19-7-5-4-6-8-19)20-9-11-29(30,31)12-10-20/h2*4-8,13-17,20,27H,9-12H2,1-3H3 |
| InChIKey | GHKWGZPITYAGCE-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 165.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.29 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |