C13H18Cl3NO3 — CID 158258093
2,6-dichloro-6-(2-pyrrolidin-1-ylethoxy)cyclohexa-2,4-diene-1-carboxylic acid;hydrochloride (PubChem CID 158258093) has the molecular formula C13H18Cl3NO3 and a molecular weight of 342.65 g/mol. Its IUPAC name is 2,6-dichloro-6-(2-pyrrolidin-1-ylethoxy)cyclohexa-2,4-diene-1-carboxylic acid;hydrochloride.
| Compound Name | 2,6-dichloro-6-(2-pyrrolidin-1-ylethoxy)cyclohexa-2,4-diene-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 158258093 |
| Molecular Formula | C13H18Cl3NO3 |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2,6-dichloro-6-(2-pyrrolidin-1-ylethoxy)cyclohexa-2,4-diene-1-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1C(Cl)=CC=CC1(Cl)OCCN1CCCC1 |
| InChI | InChI=1S/C13H17Cl2NO3.ClH/c14-10-4-3-5-13(15,11(10)12(17)18)19-9-8-16-6-1-2-7-16;/h3-5,11H,1-2,6-9H2,(H,17,18);1H |
| InChIKey | LIVMXVXYXPONLQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|