About 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole
4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole (PubChem CID 158259702) has the molecular formula C14H28N6
and a molecular weight of 280.42 g/mol. Its IUPAC name is 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole.
Molecular Properties
| Compound Name | 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole |
| PubChem CID | 158259702 |
| Molecular Formula | C14H28N6 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole |
| SMILES | C.CCCCc1cn(C)nn1.CCCc1cn(C)nn1 |
| InChI | InChI=1S/C7H13N3.C6H11N3.CH4/c1-3-4-5-7-6-10(2)9-8-7;1-3-4-6-5-9(2)8-7-6;/h6H,3-5H2,1-2H3;5H,3-4H2,1-2H3;1H4 |
| InChIKey | GHSOMHIUZVUBDE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole?
The IUPAC name of 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole (CID 158259702) is 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole.
What is the SMILES notation for 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole?
The canonical SMILES for 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole is C.CCCCc1cn(C)nn1.CCCc1cn(C)nn1.
What is the InChIKey of 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole?
The InChIKey is GHSOMHIUZVUBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3.C6H11N3.CH4/c1-3-4-5-7-6-10(2)9-8-7;1-3-4-6-5-9(2)8-7-6;/h6H,3-5H2,1-2H3;5H,3-4H2,1-2H3;1H4.
What are the key properties of 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole?
4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole has a molecular weight of 280.42 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1-methyltriazole;methane;1-methyl-4-propyltriazole is sourced from PubChem (CID 158259702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).