C46H66N4O5 — CID 158259954
4-butoxy-N-[2-(dimethylamino)-2-phenylethyl]-3,5-dimethylbenzamide;4-butoxy-3,5-dimethylbenzoic acid;N,N-dimethyl-1-phenylethane-1,2-diamine (PubChem CID 158259954) has the molecular formula C46H66N4O5 and a molecular weight of 755.06 g/mol. Its IUPAC name is 4-butoxy-N-[2-(dimethylamino)-2-phenylethyl]-3,5-dimethylbenzamide;4-butoxy-3,5-dimethylbenzoic acid;N,N-dimethyl-1-phenylethane-1,2-diamine.
| Compound Name | 4-butoxy-N-[2-(dimethylamino)-2-phenylethyl]-3,5-dimethylbenzamide;4-butoxy-3,5-dimethylbenzoic acid;N,N-dimethyl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 158259954 |
| Molecular Formula | C46H66N4O5 |
| Molecular Weight | 755.06 g/mol |
| Exact Mass | 754.50 |
| IUPAC Name | 4-butoxy-N-[2-(dimethylamino)-2-phenylethyl]-3,5-dimethylbenzamide;4-butoxy-3,5-dimethylbenzoic acid;N,N-dimethyl-1-phenylethane-1,2-diamine |
| SMILES | CCCCOc1c(C)cc(C(=O)NCC(c2ccccc2)N(C)C)cc1C.CCCCOc1c(C)cc(C(=O)O)cc1C.CN(C)C(CN)c1ccccc1 |
| InChI | InChI=1S/C23H32N2O2.C13H18O3.C10H16N2/c1-6-7-13-27-22-17(2)14-20(15-18(22)3)23(26)24-16-21(25(4)5)19-11-9-8-10-12-19;1-4-5-6-16-12-9(2)7-11(13(14)15)8-10(12)3;1-12(2)10(8-11)9-6-4-3-5-7-9/h8-12,14-15,21H,6-7,13,16H2,1-5H3,(H,24,26);7-8H,4-6H2,1-3H3,(H,14,15);3-7,10H,8,11H2,1-2H3 |
| InChIKey | GHTKFKWIIFNIPE-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.06 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|