C9H16N3+ — CID 158261460
7-propan-2-yl-2,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium (PubChem CID 158261460) has the molecular formula C9H16N3+ and a molecular weight of 166.25 g/mol. Its IUPAC name is 7-propan-2-yl-2,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium.
| Compound Name | 7-propan-2-yl-2,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium |
|---|---|
| PubChem CID | 158261460 |
| Molecular Formula | C9H16N3+ |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.13 |
| IUPAC Name | 7-propan-2-yl-2,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium |
| SMILES | CC(C)N1CC[N+]2=CCN=C2C1 |
| InChI | InChI=1S/C9H16N3/c1-8(2)12-6-5-11-4-3-10-9(11)7-12/h4,8H,3,5-7H2,1-2H3/q+1 |
| InChIKey | FUZHBDVZZXNYES-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 18.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|