About (4-oxooxolan-2-yl) 2,2-difluoropropanoate
(4-oxooxolan-2-yl) 2,2-difluoropropanoate (PubChem CID 158261846) has the molecular formula C7H8F2O4
and a molecular weight of 194.13 g/mol. Its IUPAC name is (4-oxooxolan-2-yl) 2,2-difluoropropanoate.
Molecular Properties
| Compound Name | (4-oxooxolan-2-yl) 2,2-difluoropropanoate |
| PubChem CID | 158261846 |
| Molecular Formula | C7H8F2O4 |
| Molecular Weight | 194.13 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | (4-oxooxolan-2-yl) 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OC1CC(=O)CO1 |
| InChI | InChI=1S/C7H8F2O4/c1-7(8,9)6(11)13-5-2-4(10)3-12-5/h5H,2-3H2,1H3 |
| InChIKey | NPWHWESSHPKBPO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.13 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-oxooxolan-2-yl) 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxooxolan-2-yl) 2,2-difluoropropanoate?
The IUPAC name of (4-oxooxolan-2-yl) 2,2-difluoropropanoate (CID 158261846) is (4-oxooxolan-2-yl) 2,2-difluoropropanoate.
What is the SMILES notation for (4-oxooxolan-2-yl) 2,2-difluoropropanoate?
The canonical SMILES for (4-oxooxolan-2-yl) 2,2-difluoropropanoate is CC(F)(F)C(=O)OC1CC(=O)CO1.
What is the InChIKey of (4-oxooxolan-2-yl) 2,2-difluoropropanoate?
The InChIKey is NPWHWESSHPKBPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2O4/c1-7(8,9)6(11)13-5-2-4(10)3-12-5/h5H,2-3H2,1H3.
What are the key properties of (4-oxooxolan-2-yl) 2,2-difluoropropanoate?
(4-oxooxolan-2-yl) 2,2-difluoropropanoate has a molecular weight of 194.13 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxooxolan-2-yl) 2,2-difluoropropanoate is sourced from PubChem (CID 158261846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).