C40H58N2O12 — CID 158265138
6-(carboxyamino)-5-hydroxy-2-(2-methylpropyl)-4-oxo-7-phenylheptanoic acid;5-hydroxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylpropyl)-4-oxo-7-phenylheptanoic acid (PubChem CID 158265138) has the molecular formula C40H58N2O12 and a molecular weight of 758.91 g/mol. Its IUPAC name is 6-(carboxyamino)-5-hydroxy-2-(2-methylpropyl)-4-oxo-7-phenylheptanoic acid;5-hydroxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylpropyl)-4-oxo-7-phenylheptanoic acid.
| Compound Name | 6-(carboxyamino)-5-hydroxy-2-(2-methylpropyl)-4-oxo-7-phenylheptanoic acid;5-hydroxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylpropyl)-4-oxo-7-phenylheptanoic acid |
|---|---|
| PubChem CID | 158265138 |
| Molecular Formula | C40H58N2O12 |
| Molecular Weight | 758.91 g/mol |
| Exact Mass | 758.40 |
| IUPAC Name | 6-(carboxyamino)-5-hydroxy-2-(2-methylpropyl)-4-oxo-7-phenylheptanoic acid;5-hydroxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylpropyl)-4-oxo-7-phenylheptanoic acid |
| SMILES | CC(C)CC(CC(=O)C(O)C(Cc1ccccc1)NC(=O)O)C(=O)O.CC(C)CC(CC(=O)C(O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C22H33NO6.C18H25NO6/c1-14(2)11-16(20(26)27)13-18(24)19(25)17(12-15-9-7-6-8-10-15)23-21(28)29-22(3,4)5;1-11(2)8-13(17(22)23)10-15(20)16(21)14(19-18(24)25)9-12-6-4-3-5-7-12/h6-10,14,16-17,19,25H,11-13H2,1-5H3,(H,23,28)(H,26,27);3-7,11,13-14,16,19,21H,8-10H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | GIIOTSKVTJRBPG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 236.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.91 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |