About bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate
bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate (PubChem CID 158265833) has the molecular formula C77H148O12
and a molecular weight of 1266.02 g/mol. Its IUPAC name is bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate.
Molecular Properties
| Compound Name | bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate |
| PubChem CID | 158265833 |
| Molecular Formula | C77H148O12 |
| Molecular Weight | 1266.02 g/mol |
| Exact Mass | 1265.10 |
| IUPAC Name | bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate |
| SMILES | CC(C)CCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC(C)C.CCCCCCCCOC(=O)CCCCCCCC(=O)OCCCCCCCC.CCCCCCCCOC(=O)CCCCCCCCC(=O)OCCCCCCCC |
| InChI | InChI=1S/2C26H50O4.C25H48O4/c1-23(2)17-11-7-5-9-15-21-29-25(27)19-13-14-20-26(28)30-22-16-10-6-8-12-18-24(3)4;1-3-5-7-9-15-19-23-29-25(27)21-17-13-11-12-14-18-22-26(28)30-24-20-16-10-8-6-4-2;1-3-5-7-9-14-18-22-28-24(26)20-16-12-11-13-17-21-25(27)29-23-19-15-10-8-6-4-2/h23-24H,5-22H2,1-4H3;3-24H2,1-2H3;3-23H2,1-2H3 |
| InChIKey | GIKUYOGPJOJLQU-UHFFFAOYSA-N |
| XLogP | 23.07 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 66 |
| Heavy Atoms | 89 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1266.02 |
| LogP ≤ 5 | 23.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate?
The IUPAC name of bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate (CID 158265833) is bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate.
What is the SMILES notation for bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate?
The canonical SMILES for bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate is CC(C)CCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC(C)C.CCCCCCCCOC(=O)CCCCCCCC(=O)OCCCCCCCC.CCCCCCCCOC(=O)CCCCCCCCC(=O)OCCCCCCCC.
What is the InChIKey of bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate?
The InChIKey is GIKUYOGPJOJLQU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C26H50O4.C25H48O4/c1-23(2)17-11-7-5-9-15-21-29-25(27)19-13-14-20-26(28)30-22-16-10-6-8-12-18-24(3)4;1-3-5-7-9-15-19-23-29-25(27)21-17-13-11-12-14-18-22-26(28)30-24-20-16-10-8-6-4-2;1-3-5-7-9-14-18-22-28-24(26)20-16-12-11-13-17-21-25(27)29-23-19-15-10-8-6-4-2/h23-24H,5-22H2,1-4H3;3-24H2,1-2H3;3-23H2,1-2H3.
What are the key properties of bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate?
bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate has a molecular weight of 1266.02 g/mol, XLogP of 23.07, 66 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(8-methylnonyl) hexanedioate;dioctyl decanedioate;dioctyl nonanedioate is sourced from PubChem (CID 158265833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).