dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid

H3IO6S2 — CID 158266824

IUPACdihydroxy(sulfanylidene)-λ4-sulfane;periodic acid
SMILESOS(O)=S.[O-][I+3]([O-])([O-])O
InChIInChI=1S/HIO4.H2O2S2/c2-1(3,4)5;1-4(2)3/h2H;(H2,1,2,3)
InChIKeyALQVITRSOBVTDB-UHFFFAOYSA-N
MW290.06 g/mol
LogP-7.11
Rot. Bonds

About dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid

dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid (PubChem CID 158266824) has the molecular formula H3IO6S2 and a molecular weight of 290.06 g/mol. Its IUPAC name is dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid.

Molecular Properties

Compound Namedihydroxy(sulfanylidene)-λ4-sulfane;periodic acid
PubChem CID158266824
Molecular FormulaH3IO6S2
Molecular Weight290.06 g/mol
Exact Mass289.84
IUPAC Namedihydroxy(sulfanylidene)-λ4-sulfane;periodic acid
SMILESOS(O)=S.[O-][I+3]([O-])([O-])O
InChIInChI=1S/HIO4.H2O2S2/c2-1(3,4)5;1-4(2)3/h2H;(H2,1,2,3)
InChIKeyALQVITRSOBVTDB-UHFFFAOYSA-N
XLogP-7.11
TPSA129.87 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.06
LogP ≤ 5-7.11
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid?
The IUPAC name of dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid (CID 158266824) is dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid.
What is the SMILES notation for dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid?
The canonical SMILES for dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid is OS(O)=S.[O-][I+3]([O-])([O-])O.
What is the InChIKey of dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid?
The InChIKey is ALQVITRSOBVTDB-UHFFFAOYSA-N. The full InChI is InChI=1S/HIO4.H2O2S2/c2-1(3,4)5;1-4(2)3/h2H;(H2,1,2,3).
What are the key properties of dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid?
dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid has a molecular weight of 290.06 g/mol, XLogP of -7.11, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(sulfanylidene)-λ4-sulfane;periodic acid is sourced from PubChem (CID 158266824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).