About 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride
1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride (PubChem CID 158268887) has the molecular formula C25H17ClF4O2S
and a molecular weight of 492.92 g/mol. Its IUPAC name is 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride |
| PubChem CID | 158268887 |
| Molecular Formula | C25H17ClF4O2S |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride |
| SMILES | Fc1ccc(-c2ccc(C(F)(F)F)cc2)cc1.O=S(=O)(Cl)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C13H8F4.C12H9ClO2S/c14-12-7-3-10(4-8-12)9-1-5-11(6-2-9)13(15,16)17;13-16(14,15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-8H;1-9H |
| InChIKey | GIUDKKSNOJUJCI-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride?
The IUPAC name of 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride (CID 158268887) is 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride.
What is the SMILES notation for 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride?
The canonical SMILES for 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride is Fc1ccc(-c2ccc(C(F)(F)F)cc2)cc1.O=S(=O)(Cl)c1ccccc1-c1ccccc1.
What is the InChIKey of 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride?
The InChIKey is GIUDKKSNOJUJCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F4.C12H9ClO2S/c14-12-7-3-10(4-8-12)9-1-5-11(6-2-9)13(15,16)17;13-16(14,15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-8H;1-9H.
What are the key properties of 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride?
1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride has a molecular weight of 492.92 g/mol, XLogP of 7.79, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene;2-phenylbenzenesulfonyl chloride is sourced from PubChem (CID 158268887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).