About 5-methylhexanal
5-methylhexanal (PubChem CID 15827) has the molecular formula C7H14O
and a molecular weight of 114.19 g/mol. Its IUPAC name is 5-methylhexanal.
Molecular Properties
| Compound Name | 5-methylhexanal |
| PubChem CID | 15827 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | 5-methylhexanal |
| SMILES | CC(C)CCCC=O |
| InChI | InChI=1S/C7H14O/c1-7(2)5-3-4-6-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | GEKRISJWBAIIAA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexanal?
The IUPAC name of 5-methylhexanal (CID 15827) is 5-methylhexanal.
What is the SMILES notation for 5-methylhexanal?
The canonical SMILES for 5-methylhexanal is CC(C)CCCC=O.
What is the InChIKey of 5-methylhexanal?
The InChIKey is GEKRISJWBAIIAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O/c1-7(2)5-3-4-6-8/h6-7H,3-5H2,1-2H3.
What are the key properties of 5-methylhexanal?
5-methylhexanal has a molecular weight of 114.19 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexanal is sourced from PubChem (CID 15827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).