C12H4 — CID 15827042
1,2,3,4-tetraethynylcyclobuta-1,3-diene (PubChem CID 15827042) has the molecular formula C12H4 and a molecular weight of 148.16 g/mol. Its IUPAC name is 1,2,3,4-tetraethynylcyclobuta-1,3-diene.
| Compound Name | 1,2,3,4-tetraethynylcyclobuta-1,3-diene |
|---|---|
| PubChem CID | 15827042 |
| Molecular Formula | C12H4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | 1,2,3,4-tetraethynylcyclobuta-1,3-diene |
| SMILES | C#CC1=C(C#C)C(C#C)=C1C#C |
| InChI | InChI=1S/C12H4/c1-5-9-10(6-2)12(8-4)11(9)7-3/h1-4H |
| InChIKey | HEUYILYXFVQGOW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|