C22H40O10Si — CID 158271059
(3aR,6S)-5-(2-hydroxy-3-trimethylsilylpropyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(1S,6R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-ol (PubChem CID 158271059) has the molecular formula C22H40O10Si and a molecular weight of 492.64 g/mol. Its IUPAC name is (3aR,6S)-5-(2-hydroxy-3-trimethylsilylpropyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(1S,6R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-ol.
| Compound Name | (3aR,6S)-5-(2-hydroxy-3-trimethylsilylpropyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(1S,6R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-ol |
|---|---|
| PubChem CID | 158271059 |
| Molecular Formula | C22H40O10Si |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | (3aR,6S)-5-(2-hydroxy-3-trimethylsilylpropyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(1S,6R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-ol |
| SMILES | CC1(C)OC2[C@H](OC(CC(O)C[Si](C)(C)C)[C@@H]2O)O1.CC1(C)OC2[C@H](OC3CC(O)O[C@@H]32)O1 |
| InChI | InChI=1S/C13H26O5Si.C9H14O5/c1-13(2)17-11-10(15)9(16-12(11)18-13)6-8(14)7-19(3,4)5;1-9(2)13-7-6-4(3-5(10)12-6)11-8(7)14-9/h8-12,14-15H,6-7H2,1-5H3;4-8,10H,3H2,1-2H3/t8?,9?,10-,11?,12+;4?,5?,6-,7?,8+/m00/s1 |
| InChIKey | GJANFRWEUSQOLL-UHZGYNKPSA-N |
| XLogP | 1.28 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|