About CID 158271275
CID 158271275 (PubChem CID 158271275) has the molecular formula C5H9BN2
and a molecular weight of 107.95 g/mol.
Molecular Properties
| Compound Name | CID 158271275 |
| PubChem CID | 158271275 |
| Molecular Formula | C5H9BN2 |
| Molecular Weight | 107.95 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | — |
| SMILES | [B]/C(=N\C)C(C)=CN |
| InChI | InChI=1S/C5H9BN2/c1-4(3-7)5(6)8-2/h3H,7H2,1-2H3/b4-3?,8-5- |
| InChIKey | LWGPOWZXYVHSCV-AMXUULGZSA-N |
| XLogP | 0.05 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.95 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 158271275 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158271275?
The IUPAC name of CID 158271275 (CID 158271275) is not available.
What is the SMILES notation for CID 158271275?
The canonical SMILES for CID 158271275 is [B]/C(=N\C)C(C)=CN.
What is the InChIKey of CID 158271275?
The InChIKey is LWGPOWZXYVHSCV-AMXUULGZSA-N. The full InChI is InChI=1S/C5H9BN2/c1-4(3-7)5(6)8-2/h3H,7H2,1-2H3/b4-3?,8-5-.
What are the key properties of CID 158271275?
CID 158271275 has a molecular weight of 107.95 g/mol, XLogP of 0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158271275 is sourced from PubChem (CID 158271275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).