C14H20BrO3- — CID 158272269
(6S,7aR)-3a-ethyl-2-(1-methoxyethenyl)-3-methyl-7,7a-dihydro-6H-1-benzofuran-6-ol bromide (PubChem CID 158272269) has the molecular formula C14H20BrO3- and a molecular weight of 316.22 g/mol. Its IUPAC name is (6S,7aR)-3a-ethyl-2-(1-methoxyethenyl)-3-methyl-7,7a-dihydro-6H-1-benzofuran-6-ol bromide.
| Compound Name | (6S,7aR)-3a-ethyl-2-(1-methoxyethenyl)-3-methyl-7,7a-dihydro-6H-1-benzofuran-6-ol bromide |
|---|---|
| PubChem CID | 158272269 |
| Molecular Formula | C14H20BrO3- |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (6S,7aR)-3a-ethyl-2-(1-methoxyethenyl)-3-methyl-7,7a-dihydro-6H-1-benzofuran-6-ol bromide |
| SMILES | C=C(OC)C1=C(C)C2(CC)C=C[C@@H](O)C[C@H]2O1.[Br-] |
| InChI | InChI=1S/C14H20O3.BrH/c1-5-14-7-6-11(15)8-12(14)17-13(9(14)2)10(3)16-4;/h6-7,11-12,15H,3,5,8H2,1-2,4H3;1H/p-1/t11-,12-,14?;/m1./s1 |
| InChIKey | NIKAQWSNFLMTJM-NKXVLAAZSA-M |
| XLogP | -0.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|