C36H36N4S4 — CID 158272467
2,4-dimethyl-1,3-benzothiazole;2,5-dimethyl-1,3-benzothiazole;2,6-dimethyl-1,3-benzothiazole;4,5-dimethyl-1,3-benzothiazole (PubChem CID 158272467) has the molecular formula C36H36N4S4 and a molecular weight of 652.98 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-benzothiazole;2,5-dimethyl-1,3-benzothiazole;2,6-dimethyl-1,3-benzothiazole;4,5-dimethyl-1,3-benzothiazole.
| Compound Name | 2,4-dimethyl-1,3-benzothiazole;2,5-dimethyl-1,3-benzothiazole;2,6-dimethyl-1,3-benzothiazole;4,5-dimethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 158272467 |
| Molecular Formula | C36H36N4S4 |
| Molecular Weight | 652.98 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | 2,4-dimethyl-1,3-benzothiazole;2,5-dimethyl-1,3-benzothiazole;2,6-dimethyl-1,3-benzothiazole;4,5-dimethyl-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(C)sc2c1.Cc1ccc2sc(C)nc2c1.Cc1ccc2scnc2c1C.Cc1nc2c(C)cccc2s1 |
| InChI | InChI=1S/4C9H9NS/c1-6-3-4-8-9(7(6)2)10-5-11-8;1-6-3-4-9-8(5-6)10-7(2)11-9;1-6-3-4-8-9(5-6)11-7(2)10-8;1-6-4-3-5-8-9(6)10-7(2)11-8/h4*3-5H,1-2H3 |
| InChIKey | GJEZVWWEKUXECD-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.98 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |