C27H43N — CID 158272482
1,2-ditert-butylbenzene;3,4-ditert-butylpyridine (PubChem CID 158272482) has the molecular formula C27H43N and a molecular weight of 381.65 g/mol. Its IUPAC name is 1,2-ditert-butylbenzene;3,4-ditert-butylpyridine.
| Compound Name | 1,2-ditert-butylbenzene;3,4-ditert-butylpyridine |
|---|---|
| PubChem CID | 158272482 |
| Molecular Formula | C27H43N |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.34 |
| IUPAC Name | 1,2-ditert-butylbenzene;3,4-ditert-butylpyridine |
| SMILES | CC(C)(C)c1ccccc1C(C)(C)C.CC(C)(C)c1ccncc1C(C)(C)C |
| InChI | InChI=1S/C14H22.C13H21N/c1-13(2,3)11-9-7-8-10-12(11)14(4,5)6;1-12(2,3)10-7-8-14-9-11(10)13(4,5)6/h7-10H,1-6H3;7-9H,1-6H3 |
| InChIKey | GJFBFOQRQGUEMQ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |