About potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine
potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine (PubChem CID 158272877) has the molecular formula C17H20KN3O
and a molecular weight of 321.47 g/mol. Its IUPAC name is potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine.
Molecular Properties
| Compound Name | potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine |
| PubChem CID | 158272877 |
| Molecular Formula | C17H20KN3O |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine |
| SMILES | CC(C)(C)[O-].[K+].c1ccc(Nn2ccc3ccccc32)nc1 |
| InChI | InChI=1S/C13H11N3.C4H9O.K/c1-2-6-12-11(5-1)8-10-16(12)15-13-7-3-4-9-14-13;1-4(2,3)5;/h1-10H,(H,14,15);1-3H3;/q;-1;+1 |
| InChIKey | ZXJKRYGESMAHCC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 52.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine?
The IUPAC name of potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine (CID 158272877) is potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine.
What is the SMILES notation for potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine?
The canonical SMILES for potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine is CC(C)(C)[O-].[K+].c1ccc(Nn2ccc3ccccc32)nc1.
What is the InChIKey of potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine?
The InChIKey is ZXJKRYGESMAHCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3.C4H9O.K/c1-2-6-12-11(5-1)8-10-16(12)15-13-7-3-4-9-14-13;1-4(2,3)5;/h1-10H,(H,14,15);1-3H3;/q;-1;+1.
What are the key properties of potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine?
potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine has a molecular weight of 321.47 g/mol, XLogP of 0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-methylpropan-2-olate;N-pyridin-2-ylindol-1-amine is sourced from PubChem (CID 158272877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).