About (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine
(Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine (PubChem CID 15827335) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine.
Molecular Properties
| Compound Name | (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine |
| PubChem CID | 15827335 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine |
| SMILES | CN/C(C)=C(/C)NC |
| InChI | InChI=1S/C6H14N2/c1-5(7-3)6(2)8-4/h7-8H,1-4H3/b6-5- |
| InChIKey | LFKWHOQWJZCJAT-WAYWQWQTSA-N |
| XLogP | 0.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine?
The IUPAC name of (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine (CID 15827335) is (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine.
What is the SMILES notation for (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine?
The canonical SMILES for (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine is CN/C(C)=C(/C)NC.
What is the InChIKey of (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine?
The InChIKey is LFKWHOQWJZCJAT-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H14N2/c1-5(7-3)6(2)8-4/h7-8H,1-4H3/b6-5-.
What are the key properties of (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine?
(Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine has a molecular weight of 114.19 g/mol, XLogP of 0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-N,3-N-dimethylbut-2-ene-2,3-diamine is sourced from PubChem (CID 15827335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).