C20H25N3O6 — CID 158273477
N,N-bis[2-(2,5-dioxopyrrol-1-yl)ethyl]-5,5-dimethyl-4-oxohexanamide (PubChem CID 158273477) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is N,N-bis[2-(2,5-dioxopyrrol-1-yl)ethyl]-5,5-dimethyl-4-oxohexanamide.
| Compound Name | N,N-bis[2-(2,5-dioxopyrrol-1-yl)ethyl]-5,5-dimethyl-4-oxohexanamide |
|---|---|
| PubChem CID | 158273477 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N,N-bis[2-(2,5-dioxopyrrol-1-yl)ethyl]-5,5-dimethyl-4-oxohexanamide |
| SMILES | CC(C)(C)C(=O)CCC(=O)N(CCN1C(=O)C=CC1=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H25N3O6/c1-20(2,3)14(24)4-5-15(25)21(10-12-22-16(26)6-7-17(22)27)11-13-23-18(28)8-9-19(23)29/h6-9H,4-5,10-13H2,1-3H3 |
| InChIKey | CVZPMWIJJFTJEF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|