C13H22F9NO6S3 — CID 158275519
bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;hexyl(trimethyl)azanium (PubChem CID 158275519) has the molecular formula C13H22F9NO6S3 and a molecular weight of 555.50 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;hexyl(trimethyl)azanium.
| Compound Name | bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;hexyl(trimethyl)azanium |
|---|---|
| PubChem CID | 158275519 |
| Molecular Formula | C13H22F9NO6S3 |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.05 |
| IUPAC Name | bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;hexyl(trimethyl)azanium |
| SMILES | CCCCCC[N+](C)(C)C.O=S(=O)([C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H22N.C4F9O6S3/c1-5-6-7-8-9-10(2,3)4;5-2(6,7)20(14,15)1(21(16,17)3(8,9)10)22(18,19)4(11,12)13/h5-9H2,1-4H3;/q+1;-1 |
| InChIKey | GJODYMIDLAUOPB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|