C8H13ClN6O — CID 158277317
3-amino-6-chloro-N'-ethyl-5-(hydroxymethylamino)pyrazine-2-carboximidamide (PubChem CID 158277317) has the molecular formula C8H13ClN6O and a molecular weight of 244.69 g/mol. Its IUPAC name is 3-amino-6-chloro-N'-ethyl-5-(hydroxymethylamino)pyrazine-2-carboximidamide.
| Compound Name | 3-amino-6-chloro-N'-ethyl-5-(hydroxymethylamino)pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 158277317 |
| Molecular Formula | C8H13ClN6O |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-amino-6-chloro-N'-ethyl-5-(hydroxymethylamino)pyrazine-2-carboximidamide |
| SMILES | CC/N=C(\N)c1nc(Cl)c(NCO)nc1N |
| InChI | InChI=1S/C8H13ClN6O/c1-2-12-6(10)4-7(11)15-8(13-3-16)5(9)14-4/h16H,2-3H2,1H3,(H2,10,12)(H3,11,13,15) |
| InChIKey | KKOMMRLRBNKJSM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 122.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|