About 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine
4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine (PubChem CID 158277648) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine |
| PubChem CID | 158277648 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine |
| SMILES | CC1=CC(C)=C(C(C)C)C(N)N1 |
| InChI | InChI=1S/C10H18N2/c1-6(2)9-7(3)5-8(4)12-10(9)11/h5-6,10,12H,11H2,1-4H3 |
| InChIKey | NTKJEQHYMYRXGB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine?
The IUPAC name of 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine (CID 158277648) is 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine.
What is the SMILES notation for 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine?
The canonical SMILES for 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine is CC1=CC(C)=C(C(C)C)C(N)N1.
What is the InChIKey of 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine?
The InChIKey is NTKJEQHYMYRXGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-6(2)9-7(3)5-8(4)12-10(9)11/h5-6,10,12H,11H2,1-4H3.
What are the key properties of 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine?
4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine has a molecular weight of 166.27 g/mol, XLogP of 1.75, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-3-propan-2-yl-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 158277648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).