About 5-bromo-4,6-dimethylpyridine-2,3-diamine
5-bromo-4,6-dimethylpyridine-2,3-diamine (PubChem CID 15827793) has the molecular formula C7H10BrN3
and a molecular weight of 216.08 g/mol. Its IUPAC name is 5-bromo-4,6-dimethylpyridine-2,3-diamine.
Molecular Properties
| Compound Name | 5-bromo-4,6-dimethylpyridine-2,3-diamine |
| PubChem CID | 15827793 |
| Molecular Formula | C7H10BrN3 |
| Molecular Weight | 216.08 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 5-bromo-4,6-dimethylpyridine-2,3-diamine |
| SMILES | Cc1nc(N)c(N)c(C)c1Br |
| InChI | InChI=1S/C7H10BrN3/c1-3-5(8)4(2)11-7(10)6(3)9/h9H2,1-2H3,(H2,10,11) |
| InChIKey | TZWGWIGUAUNESB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.08 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-4,6-dimethylpyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4,6-dimethylpyridine-2,3-diamine?
The IUPAC name of 5-bromo-4,6-dimethylpyridine-2,3-diamine (CID 15827793) is 5-bromo-4,6-dimethylpyridine-2,3-diamine.
What is the SMILES notation for 5-bromo-4,6-dimethylpyridine-2,3-diamine?
The canonical SMILES for 5-bromo-4,6-dimethylpyridine-2,3-diamine is Cc1nc(N)c(N)c(C)c1Br.
What is the InChIKey of 5-bromo-4,6-dimethylpyridine-2,3-diamine?
The InChIKey is TZWGWIGUAUNESB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrN3/c1-3-5(8)4(2)11-7(10)6(3)9/h9H2,1-2H3,(H2,10,11).
What are the key properties of 5-bromo-4,6-dimethylpyridine-2,3-diamine?
5-bromo-4,6-dimethylpyridine-2,3-diamine has a molecular weight of 216.08 g/mol, XLogP of 1.63, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4,6-dimethylpyridine-2,3-diamine is sourced from PubChem (CID 15827793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).