C19H14Cl2IN3O3 — CID 158279059
2-chloro-N-(3-iodo-4-methylphenyl)pyridine-4-carboxamide;2-chloropyridine-4-carboxylic acid (PubChem CID 158279059) has the molecular formula C19H14Cl2IN3O3 and a molecular weight of 530.15 g/mol. Its IUPAC name is 2-chloro-N-(3-iodo-4-methylphenyl)pyridine-4-carboxamide;2-chloropyridine-4-carboxylic acid.
| Compound Name | 2-chloro-N-(3-iodo-4-methylphenyl)pyridine-4-carboxamide;2-chloropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 158279059 |
| Molecular Formula | C19H14Cl2IN3O3 |
| Molecular Weight | 530.15 g/mol |
| Exact Mass | 528.95 |
| IUPAC Name | 2-chloro-N-(3-iodo-4-methylphenyl)pyridine-4-carboxamide;2-chloropyridine-4-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)c2ccnc(Cl)c2)cc1I.O=C(O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C13H10ClIN2O.C6H4ClNO2/c1-8-2-3-10(7-11(8)15)17-13(18)9-4-5-16-12(14)6-9;7-5-3-4(6(9)10)1-2-8-5/h2-7H,1H3,(H,17,18);1-3H,(H,9,10) |
| InChIKey | GJZDYWNXGBNDFE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.15 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|