About 7-butyl-1,4,5,6-tetrahydroinden-2-one
7-butyl-1,4,5,6-tetrahydroinden-2-one (PubChem CID 15828082) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 7-butyl-1,4,5,6-tetrahydroinden-2-one.
Molecular Properties
| Compound Name | 7-butyl-1,4,5,6-tetrahydroinden-2-one |
| PubChem CID | 15828082 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 7-butyl-1,4,5,6-tetrahydroinden-2-one |
| SMILES | CCCCC1=C2CC(=O)C=C2CCC1 |
| InChI | InChI=1S/C13H18O/c1-2-3-5-10-6-4-7-11-8-12(14)9-13(10)11/h8H,2-7,9H2,1H3 |
| InChIKey | OPZPOLWCTBLEMF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-butyl-1,4,5,6-tetrahydroinden-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butyl-1,4,5,6-tetrahydroinden-2-one?
The IUPAC name of 7-butyl-1,4,5,6-tetrahydroinden-2-one (CID 15828082) is 7-butyl-1,4,5,6-tetrahydroinden-2-one.
What is the SMILES notation for 7-butyl-1,4,5,6-tetrahydroinden-2-one?
The canonical SMILES for 7-butyl-1,4,5,6-tetrahydroinden-2-one is CCCCC1=C2CC(=O)C=C2CCC1.
What is the InChIKey of 7-butyl-1,4,5,6-tetrahydroinden-2-one?
The InChIKey is OPZPOLWCTBLEMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-2-3-5-10-6-4-7-11-8-12(14)9-13(10)11/h8H,2-7,9H2,1H3.
What are the key properties of 7-butyl-1,4,5,6-tetrahydroinden-2-one?
7-butyl-1,4,5,6-tetrahydroinden-2-one has a molecular weight of 190.29 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butyl-1,4,5,6-tetrahydroinden-2-one is sourced from PubChem (CID 15828082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).