C21H34O2Si — CID 15828083
(4aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-6,6,8-trimethyl-1,4,4a,5,7,7a-hexahydro-s-indacen-2-one (PubChem CID 15828083) has the molecular formula C21H34O2Si and a molecular weight of 346.59 g/mol. Its IUPAC name is (4aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-6,6,8-trimethyl-1,4,4a,5,7,7a-hexahydro-s-indacen-2-one.
| Compound Name | (4aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-6,6,8-trimethyl-1,4,4a,5,7,7a-hexahydro-s-indacen-2-one |
|---|---|
| PubChem CID | 15828083 |
| Molecular Formula | C21H34O2Si |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (4aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-6,6,8-trimethyl-1,4,4a,5,7,7a-hexahydro-s-indacen-2-one |
| SMILES | CC1=C2CC(=O)C=C2C[C@H]2CC(C)(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C21H34O2Si/c1-13-17-11-16(22)10-14(17)9-15-12-21(5,6)19(18(13)15)23-24(7,8)20(2,3)4/h10,15,18-19H,9,11-12H2,1-8H3/t15-,18-,19+/m0/s1 |
| InChIKey | SHKHCUODOPLWLY-ZYSHUDEJSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|