About 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate
2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate (PubChem CID 158281273) has the molecular formula C16H26O4Si
and a molecular weight of 310.47 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate |
| PubChem CID | 158281273 |
| Molecular Formula | C16H26O4Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate |
| SMILES | CC(C)(C)C#CC[C@]1(C(=O)OCC[Si](C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C16H26O4Si/c1-15(2,3)8-7-9-16(12-13(17)20-16)14(18)19-10-11-21(4,5)6/h9-12H2,1-6H3/t16-/m1/s1 |
| InChIKey | QJUKJJMAHRKOLR-MRXNPFEDSA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate?
The IUPAC name of 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate (CID 158281273) is 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate.
What is the SMILES notation for 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate?
The canonical SMILES for 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate is CC(C)(C)C#CC[C@]1(C(=O)OCC[Si](C)(C)C)CC(=O)O1.
What is the InChIKey of 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate?
The InChIKey is QJUKJJMAHRKOLR-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H26O4Si/c1-15(2,3)8-7-9-16(12-13(17)20-16)14(18)19-10-11-21(4,5)6/h9-12H2,1-6H3/t16-/m1/s1.
What are the key properties of 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate?
2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate has a molecular weight of 310.47 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl (2R)-2-(4,4-dimethylpent-2-ynyl)-4-oxooxetane-2-carboxylate is sourced from PubChem (CID 158281273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).