About 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol
9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol (PubChem CID 15828167) has the molecular formula C40H38O2
and a molecular weight of 550.74 g/mol. Its IUPAC name is 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol.
Molecular Properties
| Compound Name | 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol |
| PubChem CID | 15828167 |
| Molecular Formula | C40H38O2 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol |
| SMILES | CCc1ccc2c(c1)C(O)(c1ccc(C3(O)c4cc(CC)ccc4-c4ccc(CC)cc43)cc1)c1cc(CC)ccc1-2 |
| InChI | InChI=1S/C40H38O2/c1-5-25-9-17-31-32-18-10-26(6-2)22-36(32)39(41,35(31)21-25)29-13-15-30(16-14-29)40(42)37-23-27(7-3)11-19-33(37)34-20-12-28(8-4)24-38(34)40/h9-24,41-42H,5-8H2,1-4H3 |
| InChIKey | LUSRIZIPNQMNBT-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol?
The IUPAC name of 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol (CID 15828167) is 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol.
What is the SMILES notation for 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol?
The canonical SMILES for 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol is CCc1ccc2c(c1)C(O)(c1ccc(C3(O)c4cc(CC)ccc4-c4ccc(CC)cc43)cc1)c1cc(CC)ccc1-2.
What is the InChIKey of 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol?
The InChIKey is LUSRIZIPNQMNBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H38O2/c1-5-25-9-17-31-32-18-10-26(6-2)22-36(32)39(41,35(31)21-25)29-13-15-30(16-14-29)40(42)37-23-27(7-3)11-19-33(37)34-20-12-28(8-4)24-38(34)40/h9-24,41-42H,5-8H2,1-4H3.
What are the key properties of 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol?
9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol has a molecular weight of 550.74 g/mol, XLogP of 8.47, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-(2,7-diethyl-9-hydroxyfluoren-9-yl)phenyl]-2,7-diethylfluoren-9-ol is sourced from PubChem (CID 15828167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).