C18H29NO — CID 158282255
tert-butylbenzene;2,2-dimethylpropane;1,2-oxazole (PubChem CID 158282255) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is tert-butylbenzene;2,2-dimethylpropane;1,2-oxazole.
| Compound Name | tert-butylbenzene;2,2-dimethylpropane;1,2-oxazole |
|---|---|
| PubChem CID | 158282255 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | tert-butylbenzene;2,2-dimethylpropane;1,2-oxazole |
| SMILES | CC(C)(C)C.CC(C)(C)c1ccccc1.c1cnoc1 |
| InChI | InChI=1S/C10H14.C5H12.C3H3NO/c1-10(2,3)9-7-5-4-6-8-9;1-5(2,3)4;1-2-4-5-3-1/h4-8H,1-3H3;1-4H3;1-3H |
| InChIKey | GKITXDOITWOLNA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |