About ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one
ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one (PubChem CID 158282258) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one |
| PubChem CID | 158282258 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one |
| SMILES | CCOC(C)=O.Cc1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C4H6N2O.C4H8O2/c1-3-2-4(7)6-5-3;1-3-6-4(2)5/h2H,1H3,(H2,5,6,7);3H2,1-2H3 |
| InChIKey | GKIUABCFXNJBND-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one?
The IUPAC name of ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one (CID 158282258) is ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one.
What is the SMILES notation for ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one?
The canonical SMILES for ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one is CCOC(C)=O.Cc1cc(=O)[nH][nH]1.
What is the InChIKey of ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one?
The InChIKey is GKIUABCFXNJBND-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O.C4H8O2/c1-3-2-4(7)6-5-3;1-3-6-4(2)5/h2H,1H3,(H2,5,6,7);3H2,1-2H3.
What are the key properties of ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one?
ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one has a molecular weight of 186.21 g/mol, XLogP of 0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;5-methyl-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 158282258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).