C8H14BrFO — CID 158282620
(3R,4R,5R)-2-bromo-5-ethyl-3-fluoro-3,4-dimethyloxolane (PubChem CID 158282620) has the molecular formula C8H14BrFO and a molecular weight of 225.10 g/mol. Its IUPAC name is (3R,4R,5R)-2-bromo-5-ethyl-3-fluoro-3,4-dimethyloxolane.
| Compound Name | (3R,4R,5R)-2-bromo-5-ethyl-3-fluoro-3,4-dimethyloxolane |
|---|---|
| PubChem CID | 158282620 |
| Molecular Formula | C8H14BrFO |
| Molecular Weight | 225.10 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | (3R,4R,5R)-2-bromo-5-ethyl-3-fluoro-3,4-dimethyloxolane |
| SMILES | CC[C@H]1OC(Br)[C@](C)(F)[C@@H]1C |
| InChI | InChI=1S/C8H14BrFO/c1-4-6-5(2)8(3,10)7(9)11-6/h5-7H,4H2,1-3H3/t5-,6-,7?,8-/m1/s1 |
| InChIKey | OELVOSMKNQXLOZ-DCDLSZRSSA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.10 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|