C11H7F6N3O2S — CID 158283762
2,1,3-benzothiadiazol-5-ylmethanamine;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 158283762) has the molecular formula C11H7F6N3O2S and a molecular weight of 359.25 g/mol. Its IUPAC name is 2,1,3-benzothiadiazol-5-ylmethanamine;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 2,1,3-benzothiadiazol-5-ylmethanamine;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 158283762 |
| Molecular Formula | C11H7F6N3O2S |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 2,1,3-benzothiadiazol-5-ylmethanamine;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | NCc1ccc2nsnc2c1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H7N3S.C4F6O2/c8-4-5-1-2-6-7(3-5)10-11-9-6;5-3(6,7)1(11)2(12)4(8,9)10/h1-3H,4,8H2; |
| InChIKey | GKNCAGAJOLSGHK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|