C33H46BF4NO2S3 — CID 158285697
3-amino-4-[1-[2,6-bis(tert-butylsulfanyl)pyrylium-4-yl]ethylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]cyclobut-2-en-1-one tetrafluoroborate (PubChem CID 158285697) has the molecular formula C33H46BF4NO2S3 and a molecular weight of 671.74 g/mol. Its IUPAC name is 3-amino-4-[1-[2,6-bis(tert-butylsulfanyl)pyrylium-4-yl]ethylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]cyclobut-2-en-1-one tetrafluoroborate.
| Compound Name | 3-amino-4-[1-[2,6-bis(tert-butylsulfanyl)pyrylium-4-yl]ethylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]cyclobut-2-en-1-one tetrafluoroborate |
|---|---|
| PubChem CID | 158285697 |
| Molecular Formula | C33H46BF4NO2S3 |
| Molecular Weight | 671.74 g/mol |
| Exact Mass | 671.27 |
| IUPAC Name | 3-amino-4-[1-[2,6-bis(tert-butylsulfanyl)pyrylium-4-yl]ethylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]cyclobut-2-en-1-one tetrafluoroborate |
| SMILES | CC(=C1C(=O)C(C=C2C=C(C(C)(C)C)SC(C(C)(C)C)=C2)=C1N)c1cc(SC(C)(C)C)[o+]c(SC(C)(C)C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C33H45NO2S3.BF4/c1-19(21-17-25(38-32(8,9)10)36-26(18-21)39-33(11,12)13)27-28(34)22(29(27)35)14-20-15-23(30(2,3)4)37-24(16-20)31(5,6)7;2-1(3,4)5/h14-18H,1-13H3,(H-,34,35);/q;-1/p+1 |
| InChIKey | GKTFQZYJKPJNDP-UHFFFAOYSA-O |
| XLogP | 11.74 |
| TPSA | 54.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.74 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|