C5H9Br2F3Si — CID 15828576
(1,2-dibromo-1,2,2-trifluoroethyl)-trimethylsilane (PubChem CID 15828576) has the molecular formula C5H9Br2F3Si and a molecular weight of 314.02 g/mol. Its IUPAC name is (1,2-dibromo-1,2,2-trifluoroethyl)-trimethylsilane.
| Compound Name | (1,2-dibromo-1,2,2-trifluoroethyl)-trimethylsilane |
|---|---|
| PubChem CID | 15828576 |
| Molecular Formula | C5H9Br2F3Si |
| Molecular Weight | 314.02 g/mol |
| Exact Mass | 311.88 |
| IUPAC Name | (1,2-dibromo-1,2,2-trifluoroethyl)-trimethylsilane |
| SMILES | C[Si](C)(C)C(F)(Br)C(F)(F)Br |
| InChI | InChI=1S/C5H9Br2F3Si/c1-11(2,3)5(7,10)4(6,8)9/h1-3H3 |
| InChIKey | UKVGKULXYWZODZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.02 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|