About [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate
[3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate (PubChem CID 15828580) has the molecular formula C16H20F2O6
and a molecular weight of 346.33 g/mol. Its IUPAC name is [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate.
Molecular Properties
| Compound Name | [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate |
| PubChem CID | 15828580 |
| Molecular Formula | C16H20F2O6 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate |
| SMILES | COCCOCOC(=C(F)F)C(OC(=O)COC)c1ccccc1 |
| InChI | InChI=1S/C16H20F2O6/c1-20-8-9-22-11-23-15(16(17)18)14(24-13(19)10-21-2)12-6-4-3-5-7-12/h3-7,14H,8-11H2,1-2H3 |
| InChIKey | RSEUYEPLLMXDMH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate?
The IUPAC name of [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate (CID 15828580) is [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate.
What is the SMILES notation for [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate?
The canonical SMILES for [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate is COCCOCOC(=C(F)F)C(OC(=O)COC)c1ccccc1.
What is the InChIKey of [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate?
The InChIKey is RSEUYEPLLMXDMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F2O6/c1-20-8-9-22-11-23-15(16(17)18)14(24-13(19)10-21-2)12-6-4-3-5-7-12/h3-7,14H,8-11H2,1-2H3.
What are the key properties of [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate?
[3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate has a molecular weight of 346.33 g/mol, XLogP of 2.66, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3-difluoro-2-(2-methoxyethoxymethoxy)-1-phenylprop-2-enyl] 2-methoxyacetate is sourced from PubChem (CID 15828580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).