C13H14F2O4 — CID 15828587
methyl 3,3-difluoro-2-methoxy-4-oxo-5-phenylpentanoate (PubChem CID 15828587) has the molecular formula C13H14F2O4 and a molecular weight of 272.25 g/mol. Its IUPAC name is methyl 3,3-difluoro-2-methoxy-4-oxo-5-phenylpentanoate.
| Compound Name | methyl 3,3-difluoro-2-methoxy-4-oxo-5-phenylpentanoate |
|---|---|
| PubChem CID | 15828587 |
| Molecular Formula | C13H14F2O4 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | methyl 3,3-difluoro-2-methoxy-4-oxo-5-phenylpentanoate |
| SMILES | COC(=O)C(OC)C(F)(F)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H14F2O4/c1-18-11(12(17)19-2)13(14,15)10(16)8-9-6-4-3-5-7-9/h3-7,11H,8H2,1-2H3 |
| InChIKey | HWGOHXYPFANCFY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |